C15H30F2N4 — CID 111994171
1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-(2-ethylbutyl)-2-methylguanidine (PubChem CID 111994171) has the molecular formula C15H30F2N4 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-(2-ethylbutyl)-2-methylguanidine.
| Compound Name | 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-(2-ethylbutyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111994171 |
| Molecular Formula | C15H30F2N4 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-(2-ethylbutyl)-2-methylguanidine |
| SMILES | CCC(CC)CN/C(=N\C)NC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C15H30F2N4/c1-4-12(5-2)10-19-15(18-3)20-13-6-8-21(9-7-13)11-14(16)17/h12-14H,4-11H2,1-3H3,(H2,18,19,20) |
| InChIKey | WWSWLDHMOLGDDB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|