C21H34N6 — CID 11199539
6-N-[4-(dimethylamino)butyl]-4-N-(4,4-dimethylcyclohexyl)pyrido[3,4-d]pyrimidine-4,6-diamine (PubChem CID 11199539) has the molecular formula C21H34N6 and a molecular weight of 370.55 g/mol. Its IUPAC name is 6-N-[4-(dimethylamino)butyl]-4-N-(4,4-dimethylcyclohexyl)pyrido[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 6-N-[4-(dimethylamino)butyl]-4-N-(4,4-dimethylcyclohexyl)pyrido[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 11199539 |
| Molecular Formula | C21H34N6 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | 6-N-[4-(dimethylamino)butyl]-4-N-(4,4-dimethylcyclohexyl)pyrido[3,4-d]pyrimidine-4,6-diamine |
| SMILES | CN(C)CCCCNc1cc2c(NC3CCC(C)(C)CC3)ncnc2cn1 |
| InChI | InChI=1S/C21H34N6/c1-21(2)9-7-16(8-10-21)26-20-17-13-19(22-11-5-6-12-27(3)4)23-14-18(17)24-15-25-20/h13-16H,5-12H2,1-4H3,(H,22,23)(H,24,25,26) |
| InChIKey | UNEADUCJBQUOLV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|