C23H35IN4O3S — CID 111997076
1-ethyl-3-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-2-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide (PubChem CID 111997076) has the molecular formula C23H35IN4O3S and a molecular weight of 574.53 g/mol. Its IUPAC name is 1-ethyl-3-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-2-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-2-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111997076 |
| Molecular Formula | C23H35IN4O3S |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | 1-ethyl-3-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-2-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(C)s1)N1CCOCC1)NCC(O)c1cccc(OC)c1.I |
| InChI | InChI=1S/C23H34N4O3S.HI/c1-4-24-23(26-16-21(28)18-6-5-7-19(14-18)29-3)25-15-20(22-9-8-17(2)31-22)27-10-12-30-13-11-27;/h5-9,14,20-21,28H,4,10-13,15-16H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | HLBWXOPZCIJBJV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|