C16H26F2N4O3S — CID 111998357
1-[2-(diethylsulfamoyl)ethyl]-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine (PubChem CID 111998357) has the molecular formula C16H26F2N4O3S and a molecular weight of 392.47 g/mol. Its IUPAC name is 1-[2-(diethylsulfamoyl)ethyl]-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[2-(diethylsulfamoyl)ethyl]-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111998357 |
| Molecular Formula | C16H26F2N4O3S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-[2-(diethylsulfamoyl)ethyl]-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine |
| SMILES | CCN(CC)S(=O)(=O)CCN/C(=N\C)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C16H26F2N4O3S/c1-4-22(5-2)26(23,24)11-10-20-16(19-3)21-12-13-8-6-7-9-14(13)25-15(17)18/h6-9,15H,4-5,10-12H2,1-3H3,(H2,19,20,21) |
| InChIKey | NKNJLWCIJGSTPI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|