C17H26FN3O — CID 111998893
1-ethyl-2-[(3-fluorophenyl)methyl]-3-[(1-hydroxycyclohexyl)methyl]guanidine (PubChem CID 111998893) has the molecular formula C17H26FN3O and a molecular weight of 307.41 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluorophenyl)methyl]-3-[(1-hydroxycyclohexyl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[(3-fluorophenyl)methyl]-3-[(1-hydroxycyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111998893 |
| Molecular Formula | C17H26FN3O |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 1-ethyl-2-[(3-fluorophenyl)methyl]-3-[(1-hydroxycyclohexyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(F)c1)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C17H26FN3O/c1-2-19-16(20-12-14-7-6-8-15(18)11-14)21-13-17(22)9-4-3-5-10-17/h6-8,11,22H,2-5,9-10,12-13H2,1H3,(H2,19,20,21) |
| InChIKey | RQXOEQYLERKSRG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|