C24H48N6O — CID 111998943
1-ethyl-3-(3-methyl-2-morpholin-4-ylbutyl)-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine (PubChem CID 111998943) has the molecular formula C24H48N6O and a molecular weight of 436.69 g/mol. Its IUPAC name is 1-ethyl-3-(3-methyl-2-morpholin-4-ylbutyl)-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-methyl-2-morpholin-4-ylbutyl)-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111998943 |
| Molecular Formula | C24H48N6O |
| Molecular Weight | 436.69 g/mol |
| Exact Mass | 436.39 |
| IUPAC Name | 1-ethyl-3-(3-methyl-2-morpholin-4-ylbutyl)-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(N2CCCCC2)CCN(C)CC1)NCC(C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C24H48N6O/c1-5-25-23(26-19-22(21(2)3)29-15-17-31-18-16-29)27-20-24(9-13-28(4)14-10-24)30-11-7-6-8-12-30/h21-22H,5-20H2,1-4H3,(H2,25,26,27) |
| InChIKey | HYEHDPNSELVYMF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|