C19H32FIN4O2 — CID 111999592
N-[2-[[N-[2-(2-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111999592) has the molecular formula C19H32FIN4O2 and a molecular weight of 494.39 g/mol. Its IUPAC name is N-[2-[[N-[2-(2-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[N-[2-(2-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111999592 |
| Molecular Formula | C19H32FIN4O2 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-[2-[[N-[2-(2-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCC(CN/C(=N/C)NCCNC(=O)C(C)(C)C)Oc1ccccc1F.I |
| InChI | InChI=1S/C19H31FN4O2.HI/c1-6-14(26-16-10-8-7-9-15(16)20)13-24-18(21-5)23-12-11-22-17(25)19(2,3)4;/h7-10,14H,6,11-13H2,1-5H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | DZWYNMZEECWEPO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|