C21H32N6S — CID 111999629
2-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111999629) has the molecular formula C21H32N6S and a molecular weight of 400.60 g/mol. Its IUPAC name is 2-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 2-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111999629 |
| Molecular Formula | C21H32N6S |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 2-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCCCCC2)c1)NCCc1csc(C)n1 |
| InChI | InChI=1S/C21H32N6S/c1-3-22-21(24-11-9-19-16-28-17(2)26-19)25-15-18-8-10-23-20(14-18)27-12-6-4-5-7-13-27/h8,10,14,16H,3-7,9,11-13,15H2,1-2H3,(H2,22,24,25) |
| InChIKey | BQJXKCLAFCLNET-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|