C14H10BrF6N — CID 11200011
4-bromo-N,N-bis(2,2,2-trifluoroethyl)naphthalen-1-amine (PubChem CID 11200011) has the molecular formula C14H10BrF6N and a molecular weight of 386.13 g/mol. Its IUPAC name is 4-bromo-N,N-bis(2,2,2-trifluoroethyl)naphthalen-1-amine.
| Compound Name | 4-bromo-N,N-bis(2,2,2-trifluoroethyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 11200011 |
| Molecular Formula | C14H10BrF6N |
| Molecular Weight | 386.13 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 4-bromo-N,N-bis(2,2,2-trifluoroethyl)naphthalen-1-amine |
| SMILES | FC(F)(F)CN(CC(F)(F)F)c1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C14H10BrF6N/c15-11-5-6-12(10-4-2-1-3-9(10)11)22(7-13(16,17)18)8-14(19,20)21/h1-6H,7-8H2 |
| InChIKey | OAMBEVOJTHPNID-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.13 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |