About ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate
ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate (PubChem CID 11200145) has the molecular formula C19H16Cl2N2O3
and a molecular weight of 391.25 g/mol. Its IUPAC name is ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate |
| PubChem CID | 11200145 |
| Molecular Formula | C19H16Cl2N2O3 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(Cl)cc2Cl)c(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C19H16Cl2N2O3/c1-3-26-19(24)16-11-23(17-9-6-13(20)10-15(17)21)18(22-16)12-4-7-14(25-2)8-5-12/h4-11H,3H2,1-2H3 |
| InChIKey | YJQIERGTQRMSJC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate?
The IUPAC name of ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate (CID 11200145) is ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate.
What is the SMILES notation for ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate?
The canonical SMILES for ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate is CCOC(=O)c1cn(-c2ccc(Cl)cc2Cl)c(-c2ccc(OC)cc2)n1.
What is the InChIKey of ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate?
The InChIKey is YJQIERGTQRMSJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16Cl2N2O3/c1-3-26-19(24)16-11-23(17-9-6-13(20)10-15(17)21)18(22-16)12-4-7-14(25-2)8-5-12/h4-11H,3H2,1-2H3.
What are the key properties of ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate?
ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate has a molecular weight of 391.25 g/mol, XLogP of 5.03, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)imidazole-4-carboxylate is sourced from PubChem (CID 11200145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).