C22H31N3O4 — CID 11200444
(1S,2S,5R)-N-hydroxy-5-morpholin-4-yl-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexane-1-carboxamide (PubChem CID 11200444) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is (1S,2S,5R)-N-hydroxy-5-morpholin-4-yl-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexane-1-carboxamide.
| Compound Name | (1S,2S,5R)-N-hydroxy-5-morpholin-4-yl-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11200444 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | (1S,2S,5R)-N-hydroxy-5-morpholin-4-yl-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexane-1-carboxamide |
| SMILES | O=C(NO)[C@H]1C[C@H](N2CCOCC2)CC[C@@H]1C(=O)N1CC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C22H31N3O4/c26-21(23-28)20-14-18(24-10-12-29-13-11-24)6-7-19(20)22(27)25-9-8-17(15-25)16-4-2-1-3-5-16/h1-5,17-20,28H,6-15H2,(H,23,26)/t17-,18+,19-,20-/m0/s1 |
| InChIKey | ORORTZVNJZZXRA-YRPNKDGESA-N |
| XLogP | 1.62 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|