About 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole
4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole (PubChem CID 11200621) has the molecular formula C23H23F2N5
and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole.
Molecular Properties
| Compound Name | 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole |
| PubChem CID | 11200621 |
| Molecular Formula | C23H23F2N5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole |
| SMILES | Cc1cccc2[nH]c3c(N4CCN(CCc5ccc(F)c(F)c5)CC4)ncnc3c12 |
| InChI | InChI=1S/C23H23F2N5/c1-15-3-2-4-19-20(15)21-22(28-19)23(27-14-26-21)30-11-9-29(10-12-30)8-7-16-5-6-17(24)18(25)13-16/h2-6,13-14,28H,7-12H2,1H3 |
| InChIKey | FHHKQICOQJWLCF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole?
The IUPAC name of 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole (CID 11200621) is 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole.
What is the SMILES notation for 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole?
The canonical SMILES for 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole is Cc1cccc2[nH]c3c(N4CCN(CCc5ccc(F)c(F)c5)CC4)ncnc3c12.
What is the InChIKey of 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole?
The InChIKey is FHHKQICOQJWLCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23F2N5/c1-15-3-2-4-19-20(15)21-22(28-19)23(27-14-26-21)30-11-9-29(10-12-30)8-7-16-5-6-17(24)18(25)13-16/h2-6,13-14,28H,7-12H2,1H3.
What are the key properties of 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole?
4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole has a molecular weight of 407.47 g/mol, XLogP of 4.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-9-methyl-5H-pyrimido[5,4-b]indole is sourced from PubChem (CID 11200621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).