C21H30BrNO2 — CID 11200644
(3R,3aS)-6-bromo-3-(3,4-dimethylpent-3-enyl)-3-(methoxymethyl)-1,1-dimethyl-3a,4-dihydro-[1,3]oxazolo[3,4-a]indole (PubChem CID 11200644) has the molecular formula C21H30BrNO2 and a molecular weight of 408.38 g/mol. Its IUPAC name is (3R,3aS)-6-bromo-3-(3,4-dimethylpent-3-enyl)-3-(methoxymethyl)-1,1-dimethyl-3a,4-dihydro-[1,3]oxazolo[3,4-a]indole.
| Compound Name | (3R,3aS)-6-bromo-3-(3,4-dimethylpent-3-enyl)-3-(methoxymethyl)-1,1-dimethyl-3a,4-dihydro-[1,3]oxazolo[3,4-a]indole |
|---|---|
| PubChem CID | 11200644 |
| Molecular Formula | C21H30BrNO2 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (3R,3aS)-6-bromo-3-(3,4-dimethylpent-3-enyl)-3-(methoxymethyl)-1,1-dimethyl-3a,4-dihydro-[1,3]oxazolo[3,4-a]indole |
| SMILES | COC[C@]1(CCC(C)=C(C)C)OC(C)(C)N2c3ccc(Br)cc3C[C@H]21 |
| InChI | InChI=1S/C21H30BrNO2/c1-14(2)15(3)9-10-21(13-24-6)19-12-16-11-17(22)7-8-18(16)23(19)20(4,5)25-21/h7-8,11,19H,9-10,12-13H2,1-6H3/t19-,21-/m0/s1 |
| InChIKey | UDRZEOXVMNPBQA-FPOVZHCZSA-N |
| XLogP | 5.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|