About N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide
N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide (PubChem CID 11200665) has the molecular formula C13H8BrCl2NO3S
and a molecular weight of 409.09 g/mol. Its IUPAC name is N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide.
Molecular Properties
| Compound Name | N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide |
| PubChem CID | 11200665 |
| Molecular Formula | C13H8BrCl2NO3S |
| Molecular Weight | 409.09 g/mol |
| Exact Mass | 406.88 |
| IUPAC Name | N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide |
| SMILES | O=C(NS(=O)(=O)c1cccc(Br)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H8BrCl2NO3S/c14-8-2-1-3-10(6-8)21(19,20)17-13(18)11-5-4-9(15)7-12(11)16/h1-7H,(H,17,18) |
| InChIKey | NTPDQTIWAODSAB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.09 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide?
The IUPAC name of N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide (CID 11200665) is N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide.
What is the SMILES notation for N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide?
The canonical SMILES for N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide is O=C(NS(=O)(=O)c1cccc(Br)c1)c1ccc(Cl)cc1Cl.
What is the InChIKey of N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide?
The InChIKey is NTPDQTIWAODSAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrCl2NO3S/c14-8-2-1-3-10(6-8)21(19,20)17-13(18)11-5-4-9(15)7-12(11)16/h1-7H,(H,17,18).
What are the key properties of N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide?
N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide has a molecular weight of 409.09 g/mol, XLogP of 3.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromophenyl)sulfonyl-2,4-dichlorobenzamide is sourced from PubChem (CID 11200665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).