C27H40O3 — CID 11200774
(1R,2S,11S,14R,15S,19R,20S)-19-(2-hydroxyethyl)-1,11,15,19-tetramethyl-10-oxapentacyclo[12.8.0.02,11.04,9.015,20]docosa-4(9),5,7-trien-6-ol (PubChem CID 11200774) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is (1R,2S,11S,14R,15S,19R,20S)-19-(2-hydroxyethyl)-1,11,15,19-tetramethyl-10-oxapentacyclo[12.8.0.02,11.04,9.015,20]docosa-4(9),5,7-trien-6-ol.
| Compound Name | (1R,2S,11S,14R,15S,19R,20S)-19-(2-hydroxyethyl)-1,11,15,19-tetramethyl-10-oxapentacyclo[12.8.0.02,11.04,9.015,20]docosa-4(9),5,7-trien-6-ol |
|---|---|
| PubChem CID | 11200774 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | (1R,2S,11S,14R,15S,19R,20S)-19-(2-hydroxyethyl)-1,11,15,19-tetramethyl-10-oxapentacyclo[12.8.0.02,11.04,9.015,20]docosa-4(9),5,7-trien-6-ol |
| SMILES | C[C@]1(CCO)CCC[C@]2(C)[C@H]3CC[C@]4(C)Oc5ccc(O)cc5C[C@H]4[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C27H40O3/c1-24(14-15-28)10-5-11-25(2)21(24)8-12-26(3)22(25)9-13-27(4)23(26)17-18-16-19(29)6-7-20(18)30-27/h6-7,16,21-23,28-29H,5,8-15,17H2,1-4H3/t21-,22+,23-,24+,25-,26+,27-/m0/s1 |
| InChIKey | TUVGZIAHVBQCBH-NPLGQECHSA-N |
| XLogP | 6.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |