C24H30O6 — CID 11200812
(3S,4R,5R)-3-(2,4-dihydroxybenzoyl)-5-[(4Z)-4,8-dimethyl-6-oxonona-4,7-dienyl]-4,5-dimethyloxolan-2-one (PubChem CID 11200812) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (3S,4R,5R)-3-(2,4-dihydroxybenzoyl)-5-[(4Z)-4,8-dimethyl-6-oxonona-4,7-dienyl]-4,5-dimethyloxolan-2-one.
| Compound Name | (3S,4R,5R)-3-(2,4-dihydroxybenzoyl)-5-[(4Z)-4,8-dimethyl-6-oxonona-4,7-dienyl]-4,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 11200812 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (3S,4R,5R)-3-(2,4-dihydroxybenzoyl)-5-[(4Z)-4,8-dimethyl-6-oxonona-4,7-dienyl]-4,5-dimethyloxolan-2-one |
| SMILES | CC(C)=CC(=O)/C=C(/C)CCC[C@@]1(C)OC(=O)[C@H](C(=O)c2ccc(O)cc2O)[C@H]1C |
| InChI | InChI=1S/C24H30O6/c1-14(2)11-18(26)12-15(3)7-6-10-24(5)16(4)21(23(29)30-24)22(28)19-9-8-17(25)13-20(19)27/h8-9,11-13,16,21,25,27H,6-7,10H2,1-5H3/b15-12-/t16-,21+,24-/m1/s1 |
| InChIKey | OFAXVXGIEWFHQV-RODQJHSISA-N |
| XLogP | 4.50 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|