C20H29F3N2O4 — CID 11200909
ethyl (2S)-2-[(4S)-1,3-dicyclohexyl-2,5-dioxoimidazolidin-4-yl]-3,3,3-trifluoropropanoate (PubChem CID 11200909) has the molecular formula C20H29F3N2O4 and a molecular weight of 418.46 g/mol. Its IUPAC name is ethyl (2S)-2-[(4S)-1,3-dicyclohexyl-2,5-dioxoimidazolidin-4-yl]-3,3,3-trifluoropropanoate.
| Compound Name | ethyl (2S)-2-[(4S)-1,3-dicyclohexyl-2,5-dioxoimidazolidin-4-yl]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 11200909 |
| Molecular Formula | C20H29F3N2O4 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | ethyl (2S)-2-[(4S)-1,3-dicyclohexyl-2,5-dioxoimidazolidin-4-yl]-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)[C@H]([C@H]1C(=O)N(C2CCCCC2)C(=O)N1C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C20H29F3N2O4/c1-2-29-18(27)15(20(21,22)23)16-17(26)25(14-11-7-4-8-12-14)19(28)24(16)13-9-5-3-6-10-13/h13-16H,2-12H2,1H3/t15-,16-/m0/s1 |
| InChIKey | ANXRGWYFRHMVOX-HOTGVXAUSA-N |
| XLogP | 4.03 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|