About Hnn7HX2xal
Hnn7HX2xal (PubChem CID 11200929) has the molecular formula C25H35FO2S
and a molecular weight of 418.60 g/mol. Its IUPAC name is 2-butyl-2-[[4-fluoro-2-[(4-methoxyphenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol.
Molecular Properties
| Compound Name | Hnn7HX2xal |
| PubChem CID | 11200929 |
| Molecular Formula | C25H35FO2S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 2-butyl-2-[[4-fluoro-2-[(4-methoxyphenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol |
| SMILES | CCCCC(CCCC)(CO)CSC1=C(C=C(C=C1)F)CC2=CC=C(C=C2)OC |
| InChI | InChI=1S/C25H35FO2S/c1-4-6-14-25(18-27,15-7-5-2)19-29-24-13-10-22(26)17-21(24)16-20-8-11-23(28-3)12-9-20/h8-13,17,27H,4-7,14-16,18-19H2,1-3H3 |
| InChIKey | RTVQARXKVYWIHU-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | 417 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Hnn7HX2xal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Hnn7HX2xal?
The IUPAC name of Hnn7HX2xal (CID 11200929) is 2-butyl-2-[[4-fluoro-2-[(4-methoxyphenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol.
What is the SMILES notation for Hnn7HX2xal?
The canonical SMILES for Hnn7HX2xal is CCCCC(CCCC)(CO)CSC1=C(C=C(C=C1)F)CC2=CC=C(C=C2)OC.
What is the InChIKey of Hnn7HX2xal?
The InChIKey is RTVQARXKVYWIHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35FO2S/c1-4-6-14-25(18-27,15-7-5-2)19-29-24-13-10-22(26)17-21(24)16-20-8-11-23(28-3)12-9-20/h8-13,17,27H,4-7,14-16,18-19H2,1-3H3.
What are the key properties of Hnn7HX2xal?
Hnn7HX2xal has a molecular weight of 418.60 g/mol, XLogP of 7.80, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Hnn7HX2xal is sourced from PubChem (CID 11200929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).