About 1,1-dibromoethane
1,1-dibromoethane (PubChem CID 11201) has the molecular formula C2H4Br2
and a molecular weight of 187.86 g/mol. Its IUPAC name is 1,1-dibromoethane.
Molecular Properties
| Compound Name | 1,1-dibromoethane |
| PubChem CID | 11201 |
| Molecular Formula | C2H4Br2 |
| Molecular Weight | 187.86 g/mol |
| Exact Mass | 185.87 |
| IUPAC Name | 1,1-dibromoethane |
| SMILES | CC(Br)Br |
| InChI | InChI=1S/C2H4Br2/c1-2(3)4/h2H,1H3 |
| InChIKey | APQIUTYORBAGEZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.86 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dibromoethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibromoethane?
The IUPAC name of 1,1-dibromoethane (CID 11201) is 1,1-dibromoethane.
What is the SMILES notation for 1,1-dibromoethane?
The canonical SMILES for 1,1-dibromoethane is CC(Br)Br.
What is the InChIKey of 1,1-dibromoethane?
The InChIKey is APQIUTYORBAGEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4Br2/c1-2(3)4/h2H,1H3.
What are the key properties of 1,1-dibromoethane?
1,1-dibromoethane has a molecular weight of 187.86 g/mol, XLogP of 2.12, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibromoethane is sourced from PubChem (CID 11201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).