C20H16F3N5O3 — CID 11201276
N-[6-[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyrimidin-4-yl]acetamide (PubChem CID 11201276) has the molecular formula C20H16F3N5O3 and a molecular weight of 431.37 g/mol. Its IUPAC name is N-[6-[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyrimidin-4-yl]acetamide.
| Compound Name | N-[6-[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 11201276 |
| Molecular Formula | C20H16F3N5O3 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-[6-[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyrimidin-4-yl]acetamide |
| SMILES | CC(=O)Nc1cc(Oc2ccc(NC(=O)Nc3cccc(C(F)(F)F)c3)cc2)ncn1 |
| InChI | InChI=1S/C20H16F3N5O3/c1-12(29)26-17-10-18(25-11-24-17)31-16-7-5-14(6-8-16)27-19(30)28-15-4-2-3-13(9-15)20(21,22)23/h2-11H,1H3,(H2,27,28,30)(H,24,25,26,29) |
| InChIKey | YIXJIOOQSSSYGU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |