C22H26O9 — CID 11201358
[(1R,2R,4S,6S,8S,9S,12S,13S,14S,16S,19S)-6,9,14-trihydroxy-10,14-dimethyl-5-methylidene-18-oxo-7,17,20-trioxahexacyclo[11.5.1.19,12.01,12.04,8.016,19]icos-10-en-2-yl] acetate (PubChem CID 11201358) has the molecular formula C22H26O9 and a molecular weight of 434.44 g/mol. Its IUPAC name is [(1R,2R,4S,6S,8S,9S,12S,13S,14S,16S,19S)-6,9,14-trihydroxy-10,14-dimethyl-5-methylidene-18-oxo-7,17,20-trioxahexacyclo[11.5.1.19,12.01,12.04,8.016,19]icos-10-en-2-yl] acetate.
| Compound Name | [(1R,2R,4S,6S,8S,9S,12S,13S,14S,16S,19S)-6,9,14-trihydroxy-10,14-dimethyl-5-methylidene-18-oxo-7,17,20-trioxahexacyclo[11.5.1.19,12.01,12.04,8.016,19]icos-10-en-2-yl] acetate |
|---|---|
| PubChem CID | 11201358 |
| Molecular Formula | C22H26O9 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | [(1R,2R,4S,6S,8S,9S,12S,13S,14S,16S,19S)-6,9,14-trihydroxy-10,14-dimethyl-5-methylidene-18-oxo-7,17,20-trioxahexacyclo[11.5.1.19,12.01,12.04,8.016,19]icos-10-en-2-yl] acetate |
| SMILES | C=C1[C@H](O)O[C@@H]2[C@@H]1C[C@H](OC(C)=O)[C@]13C(=O)O[C@H]4C[C@](C)(O)[C@H]([C@H]41)[C@@]31C=C(C)[C@]2(O)O1 |
| InChI | InChI=1S/C22H26O9/c1-8-6-20-15-14-12(7-19(15,4)26)29-18(25)21(14,20)13(28-10(3)23)5-11-9(2)17(24)30-16(11)22(8,27)31-20/h6,11-17,24,26-27H,2,5,7H2,1,3-4H3/t11-,12+,13+,14+,15+,16-,17-,19+,20+,21-,22+/m1/s1 |
| InChIKey | BILSMHBWRCOPGJ-HRRUFPIJSA-N |
| XLogP | -0.07 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|