C18H16ClF3N4O4 — CID 11201638
2-tert-butyl-4-chloro-5-[[5-(2,4,5-trifluoro-3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]pyridazin-3-one (PubChem CID 11201638) has the molecular formula C18H16ClF3N4O4 and a molecular weight of 444.80 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[[5-(2,4,5-trifluoro-3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[[5-(2,4,5-trifluoro-3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 11201638 |
| Molecular Formula | C18H16ClF3N4O4 |
| Molecular Weight | 444.80 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[[5-(2,4,5-trifluoro-3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]pyridazin-3-one |
| SMILES | COc1c(F)c(F)cc(-c2nnc(COc3cnn(C(C)(C)C)c(=O)c3Cl)o2)c1F |
| InChI | InChI=1S/C18H16ClF3N4O4/c1-18(2,3)26-17(27)12(19)10(6-23-26)29-7-11-24-25-16(30-11)8-5-9(20)14(22)15(28-4)13(8)21/h5-6H,7H2,1-4H3 |
| InChIKey | ZTNZEKHLRRXQDG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.80 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|