C23H22F3N3O3 — CID 11201645
(E)-N-[2-[2-hydroxyethyl(methyl)amino]-4-methylquinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 11201645) has the molecular formula C23H22F3N3O3 and a molecular weight of 445.44 g/mol. Its IUPAC name is (E)-N-[2-[2-hydroxyethyl(methyl)amino]-4-methylquinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-[2-hydroxyethyl(methyl)amino]-4-methylquinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 11201645 |
| Molecular Formula | C23H22F3N3O3 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | (E)-N-[2-[2-hydroxyethyl(methyl)amino]-4-methylquinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | Cc1cc(N(C)CCO)nc2ccc(NC(=O)/C=C/c3ccc(OC(F)(F)F)cc3)cc12 |
| InChI | InChI=1S/C23H22F3N3O3/c1-15-13-21(29(2)11-12-30)28-20-9-6-17(14-19(15)20)27-22(31)10-5-16-3-7-18(8-4-16)32-23(24,25)26/h3-10,13-14,30H,11-12H2,1-2H3,(H,27,31)/b10-5+ |
| InChIKey | WTOMXQPJJMYNRR-BJMVGYQFSA-N |
| XLogP | 4.52 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|