About [(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate
[(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate (PubChem CID 11201656) has the molecular formula C28H31NO4
and a molecular weight of 445.56 g/mol. Its IUPAC name is [(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate.
Molecular Properties
| Compound Name | [(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate |
| PubChem CID | 11201656 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate |
| SMILES | COc1ccc(C[C@@H]2[C@H](OC(C)=O)[C@@H](OCc3ccccc3)CN2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H31NO4/c1-21(30)33-28-26(17-22-13-15-25(31-2)16-14-22)29(18-23-9-5-3-6-10-23)19-27(28)32-20-24-11-7-4-8-12-24/h3-16,26-28H,17-20H2,1-2H3/t26-,27+,28+/m1/s1 |
| InChIKey | KYROYGOUWCRVNY-PKTNWEFCSA-N |
| XLogP | 4.64 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate?
The IUPAC name of [(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate (CID 11201656) is [(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate.
What is the SMILES notation for [(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate?
The canonical SMILES for [(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate is COc1ccc(C[C@@H]2[C@H](OC(C)=O)[C@@H](OCc3ccccc3)CN2Cc2ccccc2)cc1.
What is the InChIKey of [(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate?
The InChIKey is KYROYGOUWCRVNY-PKTNWEFCSA-N. The full InChI is InChI=1S/C28H31NO4/c1-21(30)33-28-26(17-22-13-15-25(31-2)16-14-22)29(18-23-9-5-3-6-10-23)19-27(28)32-20-24-11-7-4-8-12-24/h3-16,26-28H,17-20H2,1-2H3/t26-,27+,28+/m1/s1.
What are the key properties of [(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate?
[(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate has a molecular weight of 445.56 g/mol, XLogP of 4.64, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S,4S)-1-benzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-3-yl] acetate is sourced from PubChem (CID 11201656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).