C24H46O4Si2 — CID 11201866
methyl 2-[(1R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylcyclohepta-2,6-dien-1-yl]acetate (PubChem CID 11201866) has the molecular formula C24H46O4Si2 and a molecular weight of 454.80 g/mol. Its IUPAC name is methyl 2-[(1R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylcyclohepta-2,6-dien-1-yl]acetate.
| Compound Name | methyl 2-[(1R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylcyclohepta-2,6-dien-1-yl]acetate |
|---|---|
| PubChem CID | 11201866 |
| Molecular Formula | C24H46O4Si2 |
| Molecular Weight | 454.80 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | methyl 2-[(1R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylcyclohepta-2,6-dien-1-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(O[Si](C)(C)C(C)(C)C)=C1C |
| InChI | InChI=1S/C24H46O4Si2/c1-17-19(16-21(25)26-9)14-15-20(27-29(10,11)23(3,4)5)18(2)22(17)28-30(12,13)24(6,7)8/h14-15,18-20H,16H2,1-13H3/t18-,19-,20+/m0/s1 |
| InChIKey | ZSNSHKLEWWCELZ-SLFFLAALSA-N |
| XLogP | 7.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.80 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|