C23H44O5Si2 — CID 11201918
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-ynal (PubChem CID 11201918) has the molecular formula C23H44O5Si2 and a molecular weight of 456.77 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-ynal.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-ynal |
|---|---|
| PubChem CID | 11201918 |
| Molecular Formula | C23H44O5Si2 |
| Molecular Weight | 456.77 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-ynal |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1[C@H](C#CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O5Si2/c1-17(27-29(10,11)21(2,3)4)19-20(26-23(8,9)25-19)18(15-14-16-24)28-30(12,13)22(5,6)7/h16-20H,1-13H3/t17-,18-,19-,20-/m0/s1 |
| InChIKey | FLMGDBQCFQXQOE-MUGJNUQGSA-N |
| XLogP | 5.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|