About bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium
bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium (PubChem CID 11201927) has the molecular formula C11H13F6N5O4S2
and a molecular weight of 457.38 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium |
| PubChem CID | 11201927 |
| Molecular Formula | C11H13F6N5O4S2 |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium |
| SMILES | Cn1ccnc1-c1n(C)cc[n+]1C.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H13N4.C2F6NO4S2/c1-11-5-4-10-8(11)9-12(2)6-7-13(9)3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-7H,1-3H3;/q+1;-1 |
| InChIKey | AAAICJIIHKQBGJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 109.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium (CID 11201927) is bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium is Cn1ccnc1-c1n(C)cc[n+]1C.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium?
The InChIKey is AAAICJIIHKQBGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N4.C2F6NO4S2/c1-11-5-4-10-8(11)9-12(2)6-7-13(9)3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-7H,1-3H3;/q+1;-1.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium?
bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium has a molecular weight of 457.38 g/mol, XLogP of 1.31, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;1,3-dimethyl-2-(1-methylimidazol-2-yl)imidazol-1-ium is sourced from PubChem (CID 11201927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).