C28H24N6O — CID 11202013
N-(2-cyanoethyl)-4-[[3-[(4-cyanophenyl)methyl]imidazol-4-yl]methylamino]-2-phenylbenzamide (PubChem CID 11202013) has the molecular formula C28H24N6O and a molecular weight of 460.54 g/mol. Its IUPAC name is N-(2-cyanoethyl)-4-[[3-[(4-cyanophenyl)methyl]imidazol-4-yl]methylamino]-2-phenylbenzamide.
| Compound Name | N-(2-cyanoethyl)-4-[[3-[(4-cyanophenyl)methyl]imidazol-4-yl]methylamino]-2-phenylbenzamide |
|---|---|
| PubChem CID | 11202013 |
| Molecular Formula | C28H24N6O |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N-(2-cyanoethyl)-4-[[3-[(4-cyanophenyl)methyl]imidazol-4-yl]methylamino]-2-phenylbenzamide |
| SMILES | N#CCCNC(=O)c1ccc(NCc2cncn2Cc2ccc(C#N)cc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C28H24N6O/c29-13-4-14-32-28(35)26-12-11-24(15-27(26)23-5-2-1-3-6-23)33-18-25-17-31-20-34(25)19-22-9-7-21(16-30)8-10-22/h1-3,5-12,15,17,20,33H,4,14,18-19H2,(H,32,35) |
| InChIKey | QCIVONWRSKAXKG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|