C28H31NO5 — CID 11202043
(2R,4aR,6S,7R,8R,8aS)-7-(dibenzylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 11202043) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8R,8aS)-7-(dibenzylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (2R,4aR,6S,7R,8R,8aS)-7-(dibenzylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 11202043 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (2R,4aR,6S,7R,8R,8aS)-7-(dibenzylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](O)[C@H]1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H31NO5/c1-31-28-24(29(17-20-11-5-2-6-12-20)18-21-13-7-3-8-14-21)25(30)26-23(33-28)19-32-27(34-26)22-15-9-4-10-16-22/h2-16,23-28,30H,17-19H2,1H3/t23-,24-,25-,26-,27-,28+/m1/s1 |
| InChIKey | JOHRMKKXNQELBO-PYFBZWTESA-N |
| XLogP | 3.90 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |