About N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide
N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide (PubChem CID 11202371) has the molecular formula C19H20Cl2N2O
and a molecular weight of 363.29 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide.
Molecular Properties
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide |
| PubChem CID | 11202371 |
| Molecular Formula | C19H20Cl2N2O |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC1CCN(Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C19H20Cl2N2O/c20-17-7-6-15(10-18(17)21)12-23-9-8-16(13-23)22-19(24)11-14-4-2-1-3-5-14/h1-7,10,16H,8-9,11-13H2,(H,22,24) |
| InChIKey | HIRYXRSGVDWVGH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide?
The IUPAC name of N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide (CID 11202371) is N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide.
What is the SMILES notation for N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide?
The canonical SMILES for N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide is O=C(Cc1ccccc1)NC1CCN(Cc2ccc(Cl)c(Cl)c2)C1.
What is the InChIKey of N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide?
The InChIKey is HIRYXRSGVDWVGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Cl2N2O/c20-17-7-6-15(10-18(17)21)12-23-9-8-16(13-23)22-19(24)11-14-4-2-1-3-5-14/h1-7,10,16H,8-9,11-13H2,(H,22,24).
What are the key properties of N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide?
N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide has a molecular weight of 363.29 g/mol, XLogP of 3.93, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-2-phenylacetamide is sourced from PubChem (CID 11202371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).