C19H13F6N3O5 — CID 11202372
5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(4-methoxyphenyl)-1-(4-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 11202372) has the molecular formula C19H13F6N3O5 and a molecular weight of 477.32 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(4-methoxyphenyl)-1-(4-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(4-methoxyphenyl)-1-(4-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11202372 |
| Molecular Formula | C19H13F6N3O5 |
| Molecular Weight | 477.32 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(4-methoxyphenyl)-1-(4-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc(N2C(=O)C(C(C(F)(F)F)C(F)(F)F)N(c3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H13F6N3O5/c1-33-13-8-6-11(7-9-13)27-16(29)14(15(18(20,21)22)19(23,24)25)26(17(27)30)10-2-4-12(5-3-10)28(31)32/h2-9,14-15H,1H3 |
| InChIKey | AJJUTERSBVZJPC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.32 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|