C29H34O2S2 — CID 11202409
tert-butyl 3-(2-phenylethyl)-5,5-bis(phenylsulfanyl)pentanoate (PubChem CID 11202409) has the molecular formula C29H34O2S2 and a molecular weight of 478.72 g/mol. Its IUPAC name is tert-butyl 3-(2-phenylethyl)-5,5-bis(phenylsulfanyl)pentanoate.
| Compound Name | tert-butyl 3-(2-phenylethyl)-5,5-bis(phenylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 11202409 |
| Molecular Formula | C29H34O2S2 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | tert-butyl 3-(2-phenylethyl)-5,5-bis(phenylsulfanyl)pentanoate |
| SMILES | CC(C)(C)OC(=O)CC(CCc1ccccc1)CC(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C29H34O2S2/c1-29(2,3)31-27(30)21-24(20-19-23-13-7-4-8-14-23)22-28(32-25-15-9-5-10-16-25)33-26-17-11-6-12-18-26/h4-18,24,28H,19-22H2,1-3H3 |
| InChIKey | NCMIAAHVCCSLCO-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|