C19H20ClF5N6O — CID 11202410
[4-chloro-5-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-6-(2,2,2-trifluoroethylamino)pyrimidin-2-yl]-methylcyanamide (PubChem CID 11202410) has the molecular formula C19H20ClF5N6O and a molecular weight of 478.85 g/mol. Its IUPAC name is [4-chloro-5-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-6-(2,2,2-trifluoroethylamino)pyrimidin-2-yl]-methylcyanamide.
| Compound Name | [4-chloro-5-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-6-(2,2,2-trifluoroethylamino)pyrimidin-2-yl]-methylcyanamide |
|---|---|
| PubChem CID | 11202410 |
| Molecular Formula | C19H20ClF5N6O |
| Molecular Weight | 478.85 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [4-chloro-5-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-6-(2,2,2-trifluoroethylamino)pyrimidin-2-yl]-methylcyanamide |
| SMILES | CN(C)CCCOc1cc(F)c(-c2c(Cl)nc(N(C)C#N)nc2NCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C19H20ClF5N6O/c1-30(2)5-4-6-32-11-7-12(21)14(13(22)8-11)15-16(20)28-18(31(3)10-26)29-17(15)27-9-19(23,24)25/h7-8H,4-6,9H2,1-3H3,(H,27,28,29) |
| InChIKey | ZXUDPCQCQFLPJR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 77.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|