C23H15ClN4O2S2 — CID 11202412
2-(4-chlorophenyl)-3-(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one (PubChem CID 11202412) has the molecular formula C23H15ClN4O2S2 and a molecular weight of 478.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one.
| Compound Name | 2-(4-chlorophenyl)-3-(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
|---|---|
| PubChem CID | 11202412 |
| Molecular Formula | C23H15ClN4O2S2 |
| Molecular Weight | 478.99 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
| SMILES | O=C(c1csc(-c2cccs2)n1)N1CCN2C(=O)c3ccncc3C12c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H15ClN4O2S2/c24-15-5-3-14(4-6-15)23-17-12-25-8-7-16(17)21(29)27(23)9-10-28(23)22(30)18-13-32-20(26-18)19-2-1-11-31-19/h1-8,11-13H,9-10H2 |
| InChIKey | LGMFTNMCSDUPMN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.99 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |