C13H23ClHgO4 — CID 11202419
chloro-[[(2S,3R,4R,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-3,5-dimethyloxan-2-yl]methyl]mercury (PubChem CID 11202419) has the molecular formula C13H23ClHgO4 and a molecular weight of 479.37 g/mol. Its IUPAC name is chloro-[[(2S,3R,4R,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-3,5-dimethyloxan-2-yl]methyl]mercury.
| Compound Name | chloro-[[(2S,3R,4R,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-3,5-dimethyloxan-2-yl]methyl]mercury |
|---|---|
| PubChem CID | 11202419 |
| Molecular Formula | C13H23ClHgO4 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | chloro-[[(2S,3R,4R,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-3,5-dimethyloxan-2-yl]methyl]mercury |
| SMILES | C[C@@H]1[C@@H](O)[C@@H](C)[C@@H](C[Hg]Cl)O[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C13H23O4.ClH.Hg/c1-7-9(3)16-12(8(2)11(7)14)10-6-15-13(4,5)17-10;;/h7-12,14H,3,6H2,1-2,4-5H3;1H;/q;;+1/p-1/t7-,8+,9+,10+,11-,12+;;/m0../s1 |
| InChIKey | MJPNLZPOUOEPMB-WYVPPJTKSA-M |
| XLogP | 2.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|