C19H23ClN4O2 — CID 11202624
8-(butylamino)-4-(2-chloro-4-methoxyphenyl)-6-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one (PubChem CID 11202624) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is 8-(butylamino)-4-(2-chloro-4-methoxyphenyl)-6-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one.
| Compound Name | 8-(butylamino)-4-(2-chloro-4-methoxyphenyl)-6-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 11202624 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 8-(butylamino)-4-(2-chloro-4-methoxyphenyl)-6-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one |
| SMILES | CCCCNc1cc(C)nc2c1NC(=O)CN2c1ccc(OC)cc1Cl |
| InChI | InChI=1S/C19H23ClN4O2/c1-4-5-8-21-15-9-12(2)22-19-18(15)23-17(25)11-24(19)16-7-6-13(26-3)10-14(16)20/h6-7,9-10H,4-5,8,11H2,1-3H3,(H,21,22)(H,23,25) |
| InChIKey | SDJLQXJVHZWCFR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|