C20H22ClF5N6O — CID 11202695
[4-chloro-5-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-6-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]pyrimidin-2-yl]-methylcyanamide (PubChem CID 11202695) has the molecular formula C20H22ClF5N6O and a molecular weight of 492.88 g/mol. Its IUPAC name is [4-chloro-5-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-6-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]pyrimidin-2-yl]-methylcyanamide.
| Compound Name | [4-chloro-5-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-6-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]pyrimidin-2-yl]-methylcyanamide |
|---|---|
| PubChem CID | 11202695 |
| Molecular Formula | C20H22ClF5N6O |
| Molecular Weight | 492.88 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [4-chloro-5-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-6-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]pyrimidin-2-yl]-methylcyanamide |
| SMILES | C[C@H](Nc1nc(N(C)C#N)nc(Cl)c1-c1c(F)cc(OCCCN(C)C)cc1F)C(F)(F)F |
| InChI | InChI=1S/C20H22ClF5N6O/c1-11(20(24,25)26)28-18-16(17(21)29-19(30-18)32(4)10-27)15-13(22)8-12(9-14(15)23)33-7-5-6-31(2)3/h8-9,11H,5-7H2,1-4H3,(H,28,29,30)/t11-/m0/s1 |
| InChIKey | CKWQLHOKWJDKEX-NSHDSACASA-N |
| XLogP | 4.69 |
| TPSA | 77.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.88 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|