C27H30N2O5S — CID 11202740
N-[(3,4-dimethoxyphenyl)methyl]-N-(2-oxoazepan-3-yl)-4-phenylbenzenesulfonamide (PubChem CID 11202740) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-(2-oxoazepan-3-yl)-4-phenylbenzenesulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-(2-oxoazepan-3-yl)-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 11202740 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-(2-oxoazepan-3-yl)-4-phenylbenzenesulfonamide |
| SMILES | COc1ccc(CN(C2CCCCNC2=O)S(=O)(=O)c2ccc(-c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C27H30N2O5S/c1-33-25-16-11-20(18-26(25)34-2)19-29(24-10-6-7-17-28-27(24)30)35(31,32)23-14-12-22(13-15-23)21-8-4-3-5-9-21/h3-5,8-9,11-16,18,24H,6-7,10,17,19H2,1-2H3,(H,28,30) |
| InChIKey | HVNPYZNBLOJAOL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |