About CID 11202746
CID 11202746 (PubChem CID 11202746) has the molecular formula C18H28NSn2
and a molecular weight of 495.85 g/mol.
Molecular Properties
| Compound Name | CID 11202746 |
| PubChem CID | 11202746 |
| Molecular Formula | C18H28NSn2 |
| Molecular Weight | 495.85 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | — |
| SMILES | C[Sn+](C)C.C[Sn](C)C.[NH-]c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10N.6CH3.2Sn/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;;;;;;;;/h1-9,13H;6*1H3;;/q-1;;;;;;;;+1 |
| InChIKey | BWIGZYBSVCXNGE-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.85 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 11202746 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11202746?
The IUPAC name of CID 11202746 (CID 11202746) is not available.
What is the SMILES notation for CID 11202746?
The canonical SMILES for CID 11202746 is C[Sn+](C)C.C[Sn](C)C.[NH-]c1ccccc1-c1ccccc1.
What is the InChIKey of CID 11202746?
The InChIKey is BWIGZYBSVCXNGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N.6CH3.2Sn/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;;;;;;;;/h1-9,13H;6*1H3;;/q-1;;;;;;;;+1.
What are the key properties of CID 11202746?
CID 11202746 has a molecular weight of 495.85 g/mol, XLogP of 6.78, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11202746 is sourced from PubChem (CID 11202746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).