C20H31IO5Si — CID 11202938
(2R)-2-[(1E,3R,4R,7Z)-4-hydroxy-8-iodo-3-methyl-6-oxo-3-triethylsilyloxyocta-1,7-dienyl]-2,3-dihydropyran-6-one (PubChem CID 11202938) has the molecular formula C20H31IO5Si and a molecular weight of 506.45 g/mol. Its IUPAC name is (2R)-2-[(1E,3R,4R,7Z)-4-hydroxy-8-iodo-3-methyl-6-oxo-3-triethylsilyloxyocta-1,7-dienyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1E,3R,4R,7Z)-4-hydroxy-8-iodo-3-methyl-6-oxo-3-triethylsilyloxyocta-1,7-dienyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11202938 |
| Molecular Formula | C20H31IO5Si |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | (2R)-2-[(1E,3R,4R,7Z)-4-hydroxy-8-iodo-3-methyl-6-oxo-3-triethylsilyloxyocta-1,7-dienyl]-2,3-dihydropyran-6-one |
| SMILES | CC[Si](CC)(CC)O[C@](C)(/C=C/[C@H]1CC=CC(=O)O1)[C@H](O)CC(=O)/C=C\I |
| InChI | InChI=1S/C20H31IO5Si/c1-5-27(6-2,7-3)26-20(4,18(23)15-16(22)12-14-21)13-11-17-9-8-10-19(24)25-17/h8,10-14,17-18,23H,5-7,9,15H2,1-4H3/b13-11+,14-12-/t17-,18-,20-/m1/s1 |
| InChIKey | ZILPBNMUKPCHCW-NYXFBWFZSA-N |
| XLogP | 4.46 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|