C33H41N3O2 — CID 11203034
(1S,14S,15S,18S,19S,22S,23R)-19-hydroxy-14,18-dimethyl-7-phenyl-4-propyl-4,6,8-triazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),5,7,10-tetraen-9-one (PubChem CID 11203034) has the molecular formula C33H41N3O2 and a molecular weight of 511.71 g/mol. Its IUPAC name is (1S,14S,15S,18S,19S,22S,23R)-19-hydroxy-14,18-dimethyl-7-phenyl-4-propyl-4,6,8-triazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),5,7,10-tetraen-9-one.
| Compound Name | (1S,14S,15S,18S,19S,22S,23R)-19-hydroxy-14,18-dimethyl-7-phenyl-4-propyl-4,6,8-triazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),5,7,10-tetraen-9-one |
|---|---|
| PubChem CID | 11203034 |
| Molecular Formula | C33H41N3O2 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.32 |
| IUPAC Name | (1S,14S,15S,18S,19S,22S,23R)-19-hydroxy-14,18-dimethyl-7-phenyl-4-propyl-4,6,8-triazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),5,7,10-tetraen-9-one |
| SMILES | CCCn1c2nc(-c3ccccc3)nc(=O)c-2cc2c1C[C@@H]1CC[C@@H]3[C@H](CC[C@]4(C)[C@@H](O)CC[C@@H]34)[C@@]1(C)C2 |
| InChI | InChI=1S/C33H41N3O2/c1-4-16-36-27-18-22-10-11-23-25-12-13-28(37)32(25,2)15-14-26(23)33(22,3)19-21(27)17-24-30(36)34-29(35-31(24)38)20-8-6-5-7-9-20/h5-9,17,22-23,25-26,28,37H,4,10-16,18-19H2,1-3H3/t22-,23-,25-,26-,28-,32-,33-/m0/s1 |
| InChIKey | IFYCUDHUEYGSAH-DNFUCTMPSA-N |
| XLogP | 6.14 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |