C25H34O12 — CID 11203290
[(1S,2R,4S,5R,6S,7S,9R,12R)-4,5,7,12-tetraacetyloxy-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate (PubChem CID 11203290) has the molecular formula C25H34O12 and a molecular weight of 526.54 g/mol. Its IUPAC name is [(1S,2R,4S,5R,6S,7S,9R,12R)-4,5,7,12-tetraacetyloxy-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate.
| Compound Name | [(1S,2R,4S,5R,6S,7S,9R,12R)-4,5,7,12-tetraacetyloxy-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
|---|---|
| PubChem CID | 11203290 |
| Molecular Formula | C25H34O12 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | [(1S,2R,4S,5R,6S,7S,9R,12R)-4,5,7,12-tetraacetyloxy-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12[C@H](OC(C)=O)C(=O)[C@@H]3[C@@H](OC(C)=O)[C@]1(OC3(C)C)[C@H](C)C[C@H](OC(C)=O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C25H34O12/c1-11-9-17(33-13(3)27)20(34-14(4)28)24(10-32-12(2)26)22(36-16(6)30)19(31)18-21(35-15(5)29)25(11,24)37-23(18,7)8/h11,17-18,20-22H,9-10H2,1-8H3/t11-,17+,18-,20+,21-,22-,24+,25-/m1/s1 |
| InChIKey | YLPWIVXPAOTLTE-MDUHTVMBSA-N |
| XLogP | 1.05 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|