C30H45NO5Si — CID 11203318
methyl (2R,3S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[3-(methoxymethoxy)propyl]-3-methylpiperidine-1-carboxylate (PubChem CID 11203318) has the molecular formula C30H45NO5Si and a molecular weight of 527.78 g/mol. Its IUPAC name is methyl (2R,3S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[3-(methoxymethoxy)propyl]-3-methylpiperidine-1-carboxylate.
| Compound Name | methyl (2R,3S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[3-(methoxymethoxy)propyl]-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11203318 |
| Molecular Formula | C30H45NO5Si |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | methyl (2R,3S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[3-(methoxymethoxy)propyl]-3-methylpiperidine-1-carboxylate |
| SMILES | COCOCCC[C@@H]1[C@@H](C)CC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC |
| InChI | InChI=1S/C30H45NO5Si/c1-24-19-20-25(31(29(32)34-6)28(24)18-13-21-35-23-33-5)22-36-37(30(2,3)4,26-14-9-7-10-15-26)27-16-11-8-12-17-27/h7-12,14-17,24-25,28H,13,18-23H2,1-6H3/t24-,25+,28+/m0/s1 |
| InChIKey | SYMCYSUXCRBFKA-BXTSTYNKSA-N |
| XLogP | 5.20 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|