C29H28N4O6 — CID 11203324
6-(1,3-benzodioxol-5-ylmethylamino)-2-(2,6-dimethoxy-3-pyridinyl)-N-(2-phenoxyethyl)pyridine-3-carboxamide (PubChem CID 11203324) has the molecular formula C29H28N4O6 and a molecular weight of 528.57 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethylamino)-2-(2,6-dimethoxy-3-pyridinyl)-N-(2-phenoxyethyl)pyridine-3-carboxamide.
| Compound Name | 6-(1,3-benzodioxol-5-ylmethylamino)-2-(2,6-dimethoxy-3-pyridinyl)-N-(2-phenoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11203324 |
| Molecular Formula | C29H28N4O6 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethylamino)-2-(2,6-dimethoxy-3-pyridinyl)-N-(2-phenoxyethyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(-c2nc(NCc3ccc4c(c3)OCO4)ccc2C(=O)NCCOc2ccccc2)c(OC)n1 |
| InChI | InChI=1S/C29H28N4O6/c1-35-26-13-10-22(29(33-26)36-2)27-21(28(34)30-14-15-37-20-6-4-3-5-7-20)9-12-25(32-27)31-17-19-8-11-23-24(16-19)39-18-38-23/h3-13,16H,14-15,17-18H2,1-2H3,(H,30,34)(H,31,32) |
| InChIKey | YMCJDYIILUDXOU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|