C22H31N5O9S — CID 11203532
(2S)-2-[[(2R)-2-[[(2S)-5-amino-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid (PubChem CID 11203532) has the molecular formula C22H31N5O9S and a molecular weight of 541.58 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[[(2S)-5-amino-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2R)-2-[[(2S)-5-amino-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 11203532 |
| Molecular Formula | C22H31N5O9S |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | (2S)-2-[[(2R)-2-[[(2S)-5-amino-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H31N5O9S/c23-13(9-11-1-3-12(28)4-2-11)19(32)25-14(5-7-17(24)29)20(33)27-16(10-37)21(34)26-15(22(35)36)6-8-18(30)31/h1-4,13-16,28,37H,5-10,23H2,(H2,24,29)(H,25,32)(H,26,34)(H,27,33)(H,30,31)(H,35,36)/t13-,14-,15-,16-/m0/s1 |
| InChIKey | GGXQFJYRJZAPMT-VGWMRTNUSA-N |
| XLogP | -2.14 |
| TPSA | 251.24 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|