About 2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine
2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine (PubChem CID 11203540) has the molecular formula C18H19ClF2IN3O2S
and a molecular weight of 541.79 g/mol. Its IUPAC name is 2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine |
| PubChem CID | 11203540 |
| Molecular Formula | C18H19ClF2IN3O2S |
| Molecular Weight | 541.79 g/mol |
| Exact Mass | 540.99 |
| IUPAC Name | 2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1Nc1ccc(I)cc1Cl)NC1CCCCC1 |
| InChI | InChI=1S/C18H19ClF2IN3O2S/c19-13-10-11(22)6-8-15(13)23-18-16(9-7-14(20)17(18)21)25-28(26,27)24-12-4-2-1-3-5-12/h6-10,12,23-25H,1-5H2 |
| InChIKey | SCULDGCHPWLFSO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.79 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine?
The IUPAC name of 2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine (CID 11203540) is 2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine.
What is the SMILES notation for 2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine?
The canonical SMILES for 2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine is O=S(=O)(Nc1ccc(F)c(F)c1Nc1ccc(I)cc1Cl)NC1CCCCC1.
What is the InChIKey of 2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine?
The InChIKey is SCULDGCHPWLFSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClF2IN3O2S/c19-13-10-11(22)6-8-15(13)23-18-16(9-7-14(20)17(18)21)25-28(26,27)24-12-4-2-1-3-5-12/h6-10,12,23-25H,1-5H2.
What are the key properties of 2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine?
2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine has a molecular weight of 541.79 g/mol, XLogP of 5.55, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(2-chloro-4-iodophenyl)-1-N-(cyclohexylsulfamoyl)-3,4-difluorobenzene-1,2-diamine is sourced from PubChem (CID 11203540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).