C28H30N8O4 — CID 11203547
ethyl 2-[4-[[11-(cyclohexylmethyl)-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate (PubChem CID 11203547) has the molecular formula C28H30N8O4 and a molecular weight of 542.60 g/mol. Its IUPAC name is ethyl 2-[4-[[11-(cyclohexylmethyl)-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[11-(cyclohexylmethyl)-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 11203547 |
| Molecular Formula | C28H30N8O4 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | ethyl 2-[4-[[11-(cyclohexylmethyl)-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)Nc2nc3nn(CC4CCCCC4)cc3c3nc(-c4ccco4)nn23)cc1 |
| InChI | InChI=1S/C28H30N8O4/c1-2-39-23(37)15-18-10-12-20(13-11-18)29-28(38)32-27-31-24-21(17-35(33-24)16-19-7-4-3-5-8-19)26-30-25(34-36(26)27)22-9-6-14-40-22/h6,9-14,17,19H,2-5,7-8,15-16H2,1H3,(H2,29,31,32,33,38) |
| InChIKey | AGNCVKHAYLNUQN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 141.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |