C30H41NO7Si — CID 11203714
N-[(3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanimine oxide (PubChem CID 11203714) has the molecular formula C30H41NO7Si and a molecular weight of 555.74 g/mol. Its IUPAC name is N-[(3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanimine oxide.
| Compound Name | N-[(3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanimine oxide |
|---|---|
| PubChem CID | 11203714 |
| Molecular Formula | C30H41NO7Si |
| Molecular Weight | 555.74 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | N-[(3aS,4S,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanimine oxide |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@@H]3COC(C)(C)O3)O[C@H](/[N+]([O-])=C/CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C30H41NO7Si/c1-28(2,3)39(21-14-10-8-11-15-21,22-16-12-9-13-17-22)34-19-18-31(32)27-26-25(37-30(6,7)38-26)24(35-27)23-20-33-29(4,5)36-23/h8-18,23-27H,19-20H2,1-7H3/b31-18-/t23-,24+,25-,26-,27-/m0/s1 |
| InChIKey | PKBZGWKICZRETK-JZVSEMCUSA-N |
| XLogP | 3.54 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|