C26H33ClFN11O2 — CID 11204066
4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(4-chloro-2-fluorophenyl)-2-hydroxybenzamide (PubChem CID 11204066) has the molecular formula C26H33ClFN11O2 and a molecular weight of 586.08 g/mol. Its IUPAC name is 4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(4-chloro-2-fluorophenyl)-2-hydroxybenzamide.
| Compound Name | 4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(4-chloro-2-fluorophenyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 11204066 |
| Molecular Formula | C26H33ClFN11O2 |
| Molecular Weight | 586.08 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | 4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(4-chloro-2-fluorophenyl)-2-hydroxybenzamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(C(=O)Nc4ccc(Cl)cc4F)c(O)c3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C26H33ClFN11O2/c27-13-1-4-21(20(28)5-13)34-23(41)19-3-2-18(8-22(19)40)33-24-35-25(38-9-14(29)6-15(30)10-38)37-26(36-24)39-11-16(31)7-17(32)12-39/h1-5,8,14-17,40H,6-7,9-12,29-32H2,(H,34,41)(H,33,35,36,37)/t14-,15+,16-,17+ |
| InChIKey | RAETUZOHSDBBKT-WNKDZCFJSA-N |
| XLogP | 1.10 |
| TPSA | 210.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.08 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |