C28H59IO2Si2 — CID 11204271
[(E,1R,2S,3S,4R)-1-[(2R)-butan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-2,4-dimethylhept-5-enoxy]-tri(propan-2-yl)silane (PubChem CID 11204271) has the molecular formula C28H59IO2Si2 and a molecular weight of 610.85 g/mol. Its IUPAC name is [(E,1R,2S,3S,4R)-1-[(2R)-butan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-2,4-dimethylhept-5-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(E,1R,2S,3S,4R)-1-[(2R)-butan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-2,4-dimethylhept-5-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11204271 |
| Molecular Formula | C28H59IO2Si2 |
| Molecular Weight | 610.85 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | [(E,1R,2S,3S,4R)-1-[(2R)-butan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-2,4-dimethylhept-5-enoxy]-tri(propan-2-yl)silane |
| SMILES | CC[C@@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(\C)I |
| InChI | InChI=1S/C28H59IO2Si2/c1-17-22(8)26(31-33(19(2)3,20(4)5)21(6)7)25(11)27(23(9)18-24(10)29)30-32(15,16)28(12,13)14/h18-23,25-27H,17H2,1-16H3/b24-18+/t22-,23-,25+,26-,27+/m1/s1 |
| InChIKey | BYHYRGWJKOVCCJ-ZSPMNJKISA-N |
| XLogP | 10.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.85 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|